C25H47NO2 — CID 138714869
2-[(2S)-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylethanamine (PubChem CID 138714869) has the molecular formula C25H47NO2 and a molecular weight of 393.66 g/mol. Its IUPAC name is 2-[(2S)-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[(2S)-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 138714869 |
| Molecular Formula | C25H47NO2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.36 |
| IUPAC Name | 2-[(2S)-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC1CO[C@](C)(CCN(C)C)O1 |
| InChI | InChI=1S/C25H47NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-23-27-25(2,28-24)21-22-26(3)4/h9-10,12-13,24H,5-8,11,14-23H2,1-4H3/b10-9-,13-12-/t24?,25-/m0/s1 |
| InChIKey | USBFELZJYJJRPU-BNFPXNRKSA-N |
| XLogP | 6.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|