C10H20O3 — CID 57409905
1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-ol (PubChem CID 57409905) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-ol.
| Compound Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-ol |
|---|---|
| PubChem CID | 57409905 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-ol |
| SMILES | CCCC(O)C[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H20O3/c1-4-5-8(11)6-9-7-12-10(2,3)13-9/h8-9,11H,4-7H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | KUFDEAIPVGEAIM-GKAPJAKFSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |