C12H22O3SSe — CID 100969108
(2R)-1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropane-1-selone (PubChem CID 100969108) has the molecular formula C12H22O3SSe and a molecular weight of 325.33 g/mol. Its IUPAC name is (2R)-1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropane-1-selone.
| Compound Name | (2R)-1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropane-1-selone |
|---|---|
| PubChem CID | 100969108 |
| Molecular Formula | C12H22O3SSe |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (2R)-1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypropane-1-selone |
| SMILES | CCCCSC(=[Se])[C@H](O)C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O3SSe/c1-4-5-6-16-11(17)10(13)7-9-8-14-12(2,3)15-9/h9-10,13H,4-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | SRVXWIUDCXQIIW-NXEZZACHSA-N |
| XLogP | 1.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|