C13H24O6 — CID 20700280
1,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propane-1,2-diol (PubChem CID 20700280) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propane-1,2-diol.
| Compound Name | 1,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 20700280 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propane-1,2-diol |
| SMILES | CC1(C)OCC(CC(O)C(O)C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H24O6/c1-12(2)16-6-8(18-12)5-9(14)11(15)10-7-17-13(3,4)19-10/h8-11,14-15H,5-7H2,1-4H3 |
| InChIKey | LXPFUDXUYIATKL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |