C14H24O6 — CID 11254743
(1R,2S)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethenoxyethanol (PubChem CID 11254743) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1R,2S)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethenoxyethanol.
| Compound Name | (1R,2S)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethenoxyethanol |
|---|---|
| PubChem CID | 11254743 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1R,2S)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethenoxyethanol |
| SMILES | C=CO[C@H](C1COC(C)(C)O1)[C@H](O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C14H24O6/c1-6-16-12(10-8-18-14(4,5)20-10)11(15)9-7-17-13(2,3)19-9/h6,9-12,15H,1,7-8H2,2-5H3/t9?,10?,11-,12-/m1/s1 |
| InChIKey | RYHBULXVXZGSNR-KIDURHIOSA-N |
| XLogP | 1.18 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|