About 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol
1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol (PubChem CID 123800024) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol.
Molecular Properties
| Compound Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol |
| PubChem CID | 123800024 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol |
| SMILES | COC(C1COC(C)(C)O1)C(O)C(C)C |
| InChI | InChI=1S/C11H22O4/c1-7(2)9(12)10(13-5)8-6-14-11(3,4)15-8/h7-10,12H,6H2,1-5H3 |
| InChIKey | GKZMQNDGWAIDIE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol?
The IUPAC name of 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol (CID 123800024) is 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol.
What is the SMILES notation for 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol?
The canonical SMILES for 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol is COC(C1COC(C)(C)O1)C(O)C(C)C.
What is the InChIKey of 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol?
The InChIKey is GKZMQNDGWAIDIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-7(2)9(12)10(13-5)8-6-14-11(3,4)15-8/h7-10,12H,6H2,1-5H3.
What are the key properties of 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol?
1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol has a molecular weight of 218.29 g/mol, XLogP of 1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylbutan-2-ol is sourced from PubChem (CID 123800024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).