C11H20O6 — CID 13293632
(4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-1,1-dimethoxybutan-2-one (PubChem CID 13293632) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is (4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-1,1-dimethoxybutan-2-one.
| Compound Name | (4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-1,1-dimethoxybutan-2-one |
|---|---|
| PubChem CID | 13293632 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-1,1-dimethoxybutan-2-one |
| SMILES | COC(OC)C(=O)C[C@@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H20O6/c1-11(2)16-6-9(17-11)7(12)5-8(13)10(14-3)15-4/h7,9-10,12H,5-6H2,1-4H3/t7-,9-/m1/s1 |
| InChIKey | USXPNGLXYSBLJO-VXNVDRBHSA-N |
| XLogP | 0.08 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|