C15H24Cl2O5 — CID 174619022
(2S,4S)-1,5-dichloro-2,4-bis(2,2-dimethyl-1,3-dioxolan-4-yl)pentan-3-one (PubChem CID 174619022) has the molecular formula C15H24Cl2O5 and a molecular weight of 355.26 g/mol. Its IUPAC name is (2S,4S)-1,5-dichloro-2,4-bis(2,2-dimethyl-1,3-dioxolan-4-yl)pentan-3-one.
| Compound Name | (2S,4S)-1,5-dichloro-2,4-bis(2,2-dimethyl-1,3-dioxolan-4-yl)pentan-3-one |
|---|---|
| PubChem CID | 174619022 |
| Molecular Formula | C15H24Cl2O5 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2S,4S)-1,5-dichloro-2,4-bis(2,2-dimethyl-1,3-dioxolan-4-yl)pentan-3-one |
| SMILES | CC1(C)OCC([C@H](CCl)C(=O)[C@@H](CCl)C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C15H24Cl2O5/c1-14(2)19-7-11(21-14)9(5-16)13(18)10(6-17)12-8-20-15(3,4)22-12/h9-12H,5-8H2,1-4H3/t9-,10-,11?,12?/m0/s1 |
| InChIKey | ASVOJAWBMRQRSA-JYBOHDQNSA-N |
| XLogP | 2.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|