C15H24Cl2O7 — CID 176887438
bis[2-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] carbonate (PubChem CID 176887438) has the molecular formula C15H24Cl2O7 and a molecular weight of 387.26 g/mol. Its IUPAC name is bis[2-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] carbonate.
| Compound Name | bis[2-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] carbonate |
|---|---|
| PubChem CID | 176887438 |
| Molecular Formula | C15H24Cl2O7 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | bis[2-chloro-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] carbonate |
| SMILES | CC1(C)OCC(C(CCl)OC(=O)OC(CCl)C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C15H24Cl2O7/c1-14(2)19-7-11(23-14)9(5-16)21-13(18)22-10(6-17)12-8-20-15(3,4)24-12/h9-12H,5-8H2,1-4H3 |
| InChIKey | KYGPAEZNPYJBRZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|