C15H26O3SSe — CID 10713866
1-butylsulfanyl-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]pent-4-ene-1-selone (PubChem CID 10713866) has the molecular formula C15H26O3SSe and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-butylsulfanyl-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]pent-4-ene-1-selone.
| Compound Name | 1-butylsulfanyl-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]pent-4-ene-1-selone |
|---|---|
| PubChem CID | 10713866 |
| Molecular Formula | C15H26O3SSe |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-butylsulfanyl-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]pent-4-ene-1-selone |
| SMILES | C=CCC(C(=[Se])SCCCC)C(O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H26O3SSe/c1-5-7-9-19-14(20)11(8-6-2)13(16)12-10-17-15(3,4)18-12/h6,11-13,16H,2,5,7-10H2,1,3-4H3/t11?,12-,13?/m1/s1 |
| InChIKey | BCEDSXFYGZRAIC-OTTFEQOBSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|