C15H26O6 — CID 102402641
(1R)-1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol (PubChem CID 102402641) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 102402641 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H26O6/c1-6-7-9(16)12-13(21-15(4,5)20-12)11(17)10-8-18-14(2,3)19-10/h6,9-13,16-17H,1,7-8H2,2-5H3/t9-,10-,11-,12-,13+/m1/s1 |
| InChIKey | BKYYJYBCBNDYAS-VEGXAWMVSA-N |
| XLogP | 0.96 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|