C16H28O6S2 — CID 134937196
(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-[(4S,5R)-5-[(R)-1,3-dithian-2-yl(hydroxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 134937196) has the molecular formula C16H28O6S2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-[(4S,5R)-5-[(R)-1,3-dithian-2-yl(hydroxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | (R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-[(4S,5R)-5-[(R)-1,3-dithian-2-yl(hydroxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 134937196 |
| Molecular Formula | C16H28O6S2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-[(4S,5R)-5-[(R)-1,3-dithian-2-yl(hydroxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)OCC([C@@H](O)[C@@H]2OC(C)(C)O[C@@H]2[C@@H](O)C2SCCCS2)O1 |
| InChI | InChI=1S/C16H28O6S2/c1-15(2)19-8-9(20-15)10(17)12-13(22-16(3,4)21-12)11(18)14-23-6-5-7-24-14/h9-14,17-18H,5-8H2,1-4H3/t9?,10-,11-,12+,13-/m1/s1 |
| InChIKey | UXYXRZAJXLNQOO-FOMPKITHSA-N |
| XLogP | 1.58 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |