C13H24O8S — CID 88611660
[(4R,5S)-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 88611660) has the molecular formula C13H24O8S and a molecular weight of 340.39 g/mol. Its IUPAC name is [(4R,5S)-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(4R,5S)-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88611660 |
| Molecular Formula | C13H24O8S |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(4R,5S)-5-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC1(C)OC[C@@H]([C@@H](O)[C@@H]2OC(C)(C)O[C@@H]2COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C13H24O8S/c1-12(2)17-6-8(19-12)10(14)11-9(7-18-22(5,15)16)20-13(3,4)21-11/h8-11,14H,6-7H2,1-5H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | MBQSNFMZTMZFKT-LNFKQOIKSA-N |
| XLogP | -0.00 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|