C33H48O9SSi — CID 101378996
[(E,1S,5R)-5-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-3-enyl] methanesulfonate (PubChem CID 101378996) has the molecular formula C33H48O9SSi and a molecular weight of 648.89 g/mol. Its IUPAC name is [(E,1S,5R)-5-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-3-enyl] methanesulfonate.
| Compound Name | [(E,1S,5R)-5-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-3-enyl] methanesulfonate |
|---|---|
| PubChem CID | 101378996 |
| Molecular Formula | C33H48O9SSi |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | [(E,1S,5R)-5-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxypent-3-enyl] methanesulfonate |
| SMILES | CC1(C)O[C@H]([C@H](O)/C=C/C[C@H](OS(C)(=O)=O)[C@H]2COC(C)(C)O2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C33H48O9SSi/c1-31(2,3)44(24-16-11-9-12-17-24,25-18-13-10-14-19-25)38-23-29-30(41-33(6,7)40-29)26(34)20-15-21-27(42-43(8,35)36)28-22-37-32(4,5)39-28/h9-20,26-30,34H,21-23H2,1-8H3/b20-15+/t26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | LOHWHEKSVSMSNW-QJNCRVGOSA-N |
| XLogP | 3.89 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|