C37H50O6Si — CID 70843714
(Z,5R)-1-[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]hex-2-en-1-ol (PubChem CID 70843714) has the molecular formula C37H50O6Si and a molecular weight of 618.89 g/mol. Its IUPAC name is (Z,5R)-1-[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]hex-2-en-1-ol.
| Compound Name | (Z,5R)-1-[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]hex-2-en-1-ol |
|---|---|
| PubChem CID | 70843714 |
| Molecular Formula | C37H50O6Si |
| Molecular Weight | 618.89 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | (Z,5R)-1-[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]hex-2-en-1-ol |
| SMILES | COc1ccc(CO[C@H](C)C/C=C\C(O)[C@H]2OC(C)(C)O[C@H]2CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H50O6Si/c1-28(40-27-29-21-23-30(39-7)24-22-29)15-14-20-33(38)35-34(42-37(5,6)43-35)25-26-41-44(36(2,3)4,31-16-10-8-11-17-31)32-18-12-9-13-19-32/h8-14,16-24,28,33-35,38H,15,25-27H2,1-7H3/b20-14-/t28-,33?,34+,35-/m1/s1 |
| InChIKey | JPKZLDNQRKUTNF-DCDSVAQDSA-N |
| XLogP | 6.39 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.89 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|