C43H58O8Si — CID 71100302
2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z,5S)-1-benzoyloxy-5-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate (PubChem CID 71100302) has the molecular formula C43H58O8Si and a molecular weight of 731.02 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z,5S)-1-benzoyloxy-5-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z,5S)-1-benzoyloxy-5-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 71100302 |
| Molecular Formula | C43H58O8Si |
| Molecular Weight | 731.02 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | 2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z,5S)-1-benzoyloxy-5-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate |
| SMILES | COc1ccc(CO[C@@H](C)C/C=C\C(OC(=O)c2ccccc2)C2OC(C)(C)O[C@H]2CCCc2cc(C)cc(C)c2C(=O)OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C43H58O8Si/c1-30-27-31(2)39(42(45)47-25-26-52(7,8)9)35(28-30)18-14-20-38-40(51-43(4,5)50-38)37(49-41(44)34-16-11-10-12-17-34)19-13-15-32(3)48-29-33-21-23-36(46-6)24-22-33/h10-13,16-17,19,21-24,27-28,32,37-38,40H,14-15,18,20,25-26,29H2,1-9H3/b19-13-/t32-,37?,38-,40?/m0/s1 |
| InChIKey | KHJNLLWRIJPBEP-VRHDZKQMSA-N |
| XLogP | 9.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.02 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|