C39H56O6Si — CID 58304980
2-trimethylsilylethyl 2-[(E)-3-[5-[(Z)-4-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate (PubChem CID 58304980) has the molecular formula C39H56O6Si and a molecular weight of 648.96 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(E)-3-[5-[(Z)-4-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[(E)-3-[5-[(Z)-4-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 58304980 |
| Molecular Formula | C39H56O6Si |
| Molecular Weight | 648.96 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(E)-3-[5-[(Z)-4-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate |
| SMILES | COc1ccc(CO[C@H]2CCC[C@@H]2/C=C\C(C)C2OC(C)(C)OC2C/C=C/c2cc(C)cc(C)c2C(=O)OCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C39H56O6Si/c1-27-24-29(3)36(38(40)42-22-23-46(7,8)9)32(25-27)13-11-15-35-37(45-39(4,5)44-35)28(2)16-19-31-12-10-14-34(31)43-26-30-17-20-33(41-6)21-18-30/h11,13,16-21,24-25,28,31,34-35,37H,10,12,14-15,22-23,26H2,1-9H3/b13-11+,19-16-/t28?,31-,34+,35?,37?/m1/s1 |
| InChIKey | VQQCJWFFYCNLDG-MJIYUYRASA-N |
| XLogP | 9.31 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.96 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|