C28H44O7Si — CID 58304633
2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-enyl]-4,6-dimethylbenzoate (PubChem CID 58304633) has the molecular formula C28H44O7Si and a molecular weight of 520.74 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-enyl]-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-enyl]-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 58304633 |
| Molecular Formula | C28H44O7Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-enyl]-4,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC[Si](C)(C)C)c(/C=C/C(O)[C@@H]2OC(C)(C)O[C@@H]2COC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H44O7Si/c1-18-15-19(2)23(25(30)32-13-14-36(8,9)10)20(16-18)11-12-21(29)24-22(34-28(6,7)35-24)17-33-26(31)27(3,4)5/h11-12,15-16,21-22,24,29H,13-14,17H2,1-10H3/b12-11+/t21?,22-,24+/m1/s1 |
| InChIKey | DOUAPUZMBRZXFG-RUFNPULDSA-N |
| XLogP | 5.28 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|