C29H46O5Si — CID 58305110
2-trimethylsilylethyl 2-[(E)-3-[5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate (PubChem CID 58305110) has the molecular formula C29H46O5Si and a molecular weight of 502.77 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(E)-3-[5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[(E)-3-[5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 58305110 |
| Molecular Formula | C29H46O5Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(E)-3-[5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC[Si](C)(C)C)c(/C=C/CC2OC(C)(C)OC2C(C)/C=C\C[C@@H](C)O)c1 |
| InChI | InChI=1S/C29H46O5Si/c1-20-18-22(3)26(28(31)32-16-17-35(7,8)9)24(19-20)14-11-15-25-27(34-29(5,6)33-25)21(2)12-10-13-23(4)30/h10-12,14,18-19,21,23,25,27,30H,13,15-17H2,1-9H3/b12-10-,14-11+/t21?,23-,25?,27?/m1/s1 |
| InChIKey | AXYYPICFRLTZPF-JKTTVFSCSA-N |
| XLogP | 6.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|