C29H46O8Si — CID 89023994
trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4,6-trimethoxybenzoate (PubChem CID 89023994) has the molecular formula C29H46O8Si and a molecular weight of 550.77 g/mol. Its IUPAC name is trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4,6-trimethoxybenzoate.
| Compound Name | trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4,6-trimethoxybenzoate |
|---|---|
| PubChem CID | 89023994 |
| Molecular Formula | C29H46O8Si |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | trimethylsilylmethyl 2-[(E)-3-[(4S,5R)-5-[(Z,6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4,6-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OC[Si](C)(C)C)c(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(C)/C=C\C[C@@H](C)O)c1OC |
| InChI | InChI=1S/C29H46O8Si/c1-19(13-11-14-20(2)30)26-22(36-29(3,4)37-26)16-12-15-21-25(28(31)35-18-38(8,9)10)23(32-5)17-24(33-6)27(21)34-7/h11-13,15,17,19-20,22,26,30H,14,16,18H2,1-10H3/b13-11-,15-12+/t19?,20-,22+,26-/m1/s1 |
| InChIKey | RYPAHRFOTXNXAE-JOVTVYSASA-N |
| XLogP | 5.63 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|