C25H36O10 — CID 90860783
6-[3-[(4S,5R)-5-[(5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4-dimethoxy-2-(methoxymethoxy)benzoic acid (PubChem CID 90860783) has the molecular formula C25H36O10 and a molecular weight of 496.55 g/mol. Its IUPAC name is 6-[3-[(4S,5R)-5-[(5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4-dimethoxy-2-(methoxymethoxy)benzoic acid.
| Compound Name | 6-[3-[(4S,5R)-5-[(5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4-dimethoxy-2-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 90860783 |
| Molecular Formula | C25H36O10 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 6-[3-[(4S,5R)-5-[(5S)-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,4-dimethoxy-2-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1c(OC)c(OC)cc(C=CC[C@@H]2OC(C)(C)O[C@@H]2C(O)C=CC[C@H](C)O)c1C(=O)O |
| InChI | InChI=1S/C25H36O10/c1-15(26)9-7-11-17(27)21-18(34-25(2,3)35-21)12-8-10-16-13-19(31-5)22(32-6)23(33-14-30-4)20(16)24(28)29/h7-8,10-11,13,15,17-18,21,26-27H,9,12,14H2,1-6H3,(H,28,29)/t15-,17?,18-,21+/m0/s1 |
| InChIKey | NURHXUAIZFTNSU-GRGKTJMESA-N |
| XLogP | 3.00 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|