C30H38O9 — CID 101179204
2-hydroxy-6-[(E)-3-[(4S,5S)-5-[(Z,1R,5R)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxybenzoic acid (PubChem CID 101179204) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is 2-hydroxy-6-[(E)-3-[(4S,5S)-5-[(Z,1R,5R)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxybenzoic acid.
| Compound Name | 2-hydroxy-6-[(E)-3-[(4S,5S)-5-[(Z,1R,5R)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 101179204 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2-hydroxy-6-[(E)-3-[(4S,5S)-5-[(Z,1R,5R)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(CO[C@H](/C=C\C[C@@H](C)O)[C@H]2OC(C)(C)O[C@H]2C/C=C/c2cc(OC)cc(O)c2C(=O)O)cc1 |
| InChI | InChI=1S/C30H38O9/c1-19(31)8-6-10-25(37-18-20-12-14-22(35-4)15-13-20)28-26(38-30(2,3)39-28)11-7-9-21-16-23(36-5)17-24(32)27(21)29(33)34/h6-7,9-10,12-17,19,25-26,28,31-32H,8,11,18H2,1-5H3,(H,33,34)/b9-7+,10-6-/t19-,25-,26+,28-/m1/s1 |
| InChIKey | RNLLXBGKVTTYND-QJLDVWHYSA-N |
| XLogP | 4.94 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|