C32H40O9 — CID 123720102
carbon dioxide;2-[(E)-3-[(4S,5S)-5-[(Z,5S)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,6-dimethylbenzoic acid (PubChem CID 123720102) has the molecular formula C32H40O9 and a molecular weight of 568.66 g/mol. Its IUPAC name is carbon dioxide;2-[(E)-3-[(4S,5S)-5-[(Z,5S)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,6-dimethylbenzoic acid.
| Compound Name | carbon dioxide;2-[(E)-3-[(4S,5S)-5-[(Z,5S)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 123720102 |
| Molecular Formula | C32H40O9 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | carbon dioxide;2-[(E)-3-[(4S,5S)-5-[(Z,5S)-5-hydroxy-1-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-3,6-dimethylbenzoic acid |
| SMILES | COc1ccc(COC(/C=C\C[C@H](C)O)[C@H]2OC(C)(C)O[C@H]2C/C=C/c2c(C)ccc(C)c2C(=O)O)cc1.O=C=O |
| InChI | InChI=1S/C31H40O7.CO2/c1-20-13-14-21(2)28(30(33)34)25(20)10-8-12-27-29(38-31(4,5)37-27)26(11-7-9-22(3)32)36-19-23-15-17-24(35-6)18-16-23;2-1-3/h7-8,10-11,13-18,22,26-27,29,32H,9,12,19H2,1-6H3,(H,33,34);/b10-8+,11-7-;/t22-,26?,27-,29+;/m0./s1 |
| InChIKey | YAHDPMOOOKNILQ-DFWKXVAWSA-N |
| XLogP | 5.26 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|