C32H42O11 — CID 91460408
2-[3-[(4S,5R)-5-[(4R,5S)-1,5-dihydroxy-4-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid (PubChem CID 91460408) has the molecular formula C32H42O11 and a molecular weight of 602.68 g/mol. Its IUPAC name is 2-[3-[(4S,5R)-5-[(4R,5S)-1,5-dihydroxy-4-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid.
| Compound Name | 2-[3-[(4S,5R)-5-[(4R,5S)-1,5-dihydroxy-4-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 91460408 |
| Molecular Formula | C32H42O11 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 2-[3-[(4S,5R)-5-[(4R,5S)-1,5-dihydroxy-4-[(4-methoxyphenyl)methoxy]hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1cc(OC)cc(C=CC[C@@H]2OC(C)(C)O[C@@H]2C(O)C=C[C@@H](OCc2ccc(OC)cc2)[C@H](C)O)c1C(=O)O |
| InChI | InChI=1S/C32H42O11/c1-20(33)26(40-18-21-10-12-23(38-5)13-11-21)15-14-25(34)30-27(42-32(2,3)43-30)9-7-8-22-16-24(39-6)17-28(41-19-37-4)29(22)31(35)36/h7-8,10-17,20,25-27,30,33-34H,9,18-19H2,1-6H3,(H,35,36)/t20-,25?,26+,27-,30+/m0/s1 |
| InChIKey | KVRCWPCJAXMPBD-BXLLCJNFSA-N |
| XLogP | 4.19 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|