C25H36O8 — CID 59466745
2-[(E)-3-[(4R,5R)-5-[(Z,4S,5S)-1,5-dihydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-methylbenzoic acid (PubChem CID 59466745) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-[(E)-3-[(4R,5R)-5-[(Z,4S,5S)-1,5-dihydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-methylbenzoic acid.
| Compound Name | 2-[(E)-3-[(4R,5R)-5-[(Z,4S,5S)-1,5-dihydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 59466745 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[(E)-3-[(4R,5R)-5-[(Z,4S,5S)-1,5-dihydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-methylbenzoic acid |
| SMILES | COCOc1cc(C)cc(/C=C/C[C@H]2OC(C)(C)O[C@@H]2C(O)/C=C\[C@H](C)[C@H](C)O)c1C(=O)O |
| InChI | InChI=1S/C25H36O8/c1-15-12-18(22(24(28)29)21(13-15)31-14-30-6)8-7-9-20-23(33-25(4,5)32-20)19(27)11-10-16(2)17(3)26/h7-8,10-13,16-17,19-20,23,26-27H,9,14H2,1-6H3,(H,28,29)/b8-7+,11-10-/t16-,17-,19?,20+,23+/m0/s1 |
| InChIKey | LAFWYAUDLRWRTH-IHAWIHDFSA-N |
| XLogP | 3.53 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|