C33H40N2O9 — CID 59467150
4-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-1-methylbenzimidazole-5-carboxylic acid (PubChem CID 59467150) has the molecular formula C33H40N2O9 and a molecular weight of 608.69 g/mol. Its IUPAC name is 4-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-1-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 4-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-1-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59467150 |
| Molecular Formula | C33H40N2O9 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 4-[(E)-3-[(4S,5S)-5-[(Z,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-1-methylbenzimidazole-5-carboxylic acid |
| SMILES | COCOc1cc2c(ncn2C)c(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(/C=C\[C@@H](C)[C@H](C)O)OC(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C33H40N2O9/c1-20(21(2)36)15-16-25(42-32(39)22-11-8-7-9-12-22)30-26(43-33(3,4)44-30)14-10-13-23-28(31(37)38)27(41-19-40-6)17-24-29(23)34-18-35(24)5/h7-13,15-18,20-21,25-26,30,36H,14,19H2,1-6H3,(H,37,38)/b13-10+,16-15-/t20-,21+,25?,26+,30-/m1/s1 |
| InChIKey | KIQVXVQIGUBTKF-OUXGFOSVSA-N |
| XLogP | 4.98 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|