C22H32O8 — CID 91513318
[(4R,5S)-5-hydroxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate (PubChem CID 91513318) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(4R,5S)-5-hydroxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate.
| Compound Name | [(4R,5S)-5-hydroxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate |
|---|---|
| PubChem CID | 91513318 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(4R,5S)-5-hydroxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate |
| SMILES | COCO[C@H](C=CC(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CCO)[C@H](C)O |
| InChI | InChI=1S/C22H32O8/c1-15(24)17(27-14-26-4)10-11-18(28-21(25)16-8-6-5-7-9-16)20-19(12-13-23)29-22(2,3)30-20/h5-11,15,17-20,23-24H,12-14H2,1-4H3/t15-,17+,18?,19-,20+/m0/s1 |
| InChIKey | CSOLCMACESEYHN-NTHMGXEOSA-N |
| XLogP | 2.04 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|