C38H50O8Si — CID 91491485
[(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate (PubChem CID 91491485) has the molecular formula C38H50O8Si and a molecular weight of 662.90 g/mol. Its IUPAC name is [(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate.
| Compound Name | [(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate |
|---|---|
| PubChem CID | 91491485 |
| Molecular Formula | C38H50O8Si |
| Molecular Weight | 662.90 g/mol |
| Exact Mass | 662.33 |
| IUPAC Name | [(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)hex-2-enyl] benzoate |
| SMILES | COCO[C@H](C=CC(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CCO)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H50O8Si/c1-28(46-47(37(2,3)4,30-19-13-9-14-20-30)31-21-15-10-16-22-31)32(42-27-41-7)23-24-33(43-36(40)29-17-11-8-12-18-29)35-34(25-26-39)44-38(5,6)45-35/h8-24,28,32-35,39H,25-27H2,1-7H3/t28-,32+,33?,34-,35+/m0/s1 |
| InChIKey | LETVAKNAKMZOPD-PLZUBVSLSA-N |
| XLogP | 5.62 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.90 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|