C37H46FIO5Si — CID 90946570
[(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate (PubChem CID 90946570) has the molecular formula C37H46FIO5Si and a molecular weight of 744.76 g/mol. Its IUPAC name is [(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate.
| Compound Name | [(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate |
|---|---|
| PubChem CID | 90946570 |
| Molecular Formula | C37H46FIO5Si |
| Molecular Weight | 744.76 g/mol |
| Exact Mass | 744.21 |
| IUPAC Name | [(4R,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate |
| SMILES | C[C@H](C=C(F)C(OC(=O)c1ccccc1)C1OC(C)(C)O[C@H]1CCI)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H46FIO5Si/c1-26(27(2)44-45(36(3,4)5,29-19-13-9-14-20-29)30-21-15-10-16-22-30)25-31(38)33(41-35(40)28-17-11-8-12-18-28)34-32(23-24-39)42-37(6,7)43-34/h8-22,25-27,32-34H,23-24H2,1-7H3/t26-,27-,32+,33?,34?/m1/s1 |
| InChIKey | VDILHDGNRIGXDT-HBLSIECJSA-N |
| XLogP | 8.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.76 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|