C21H28FIO4 — CID 58304717
[(E)-2-fluoro-1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate (PubChem CID 58304717) has the molecular formula C21H28FIO4 and a molecular weight of 490.35 g/mol. Its IUPAC name is [(E)-2-fluoro-1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate.
| Compound Name | [(E)-2-fluoro-1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate |
|---|---|
| PubChem CID | 58304717 |
| Molecular Formula | C21H28FIO4 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [(E)-2-fluoro-1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate |
| SMILES | CC(C)C/C=C(/F)C(OC(=O)c1ccccc1)C1OC(C)(C)OC1CCI |
| InChI | InChI=1S/C21H28FIO4/c1-14(2)10-11-16(22)18(25-20(24)15-8-6-5-7-9-15)19-17(12-13-23)26-21(3,4)27-19/h5-9,11,14,17-19H,10,12-13H2,1-4H3/b16-11+ |
| InChIKey | RPMDCBTWPOMHPP-LFIBNONCSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|