C27H30O6 — CID 14504024
[(1R)-1-[(4S,5S)-5-[(1R)-1-benzoyloxybut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] benzoate (PubChem CID 14504024) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1R)-1-[(4S,5S)-5-[(1R)-1-benzoyloxybut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] benzoate.
| Compound Name | [(1R)-1-[(4S,5S)-5-[(1R)-1-benzoyloxybut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] benzoate |
|---|---|
| PubChem CID | 14504024 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [(1R)-1-[(4S,5S)-5-[(1R)-1-benzoyloxybut-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] benzoate |
| SMILES | C=CC[C@@H](OC(=O)c1ccccc1)[C@@H]1OC(C)(C)O[C@H]1[C@@H](CC=C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30O6/c1-5-13-21(30-25(28)19-15-9-7-10-16-19)23-24(33-27(3,4)32-23)22(14-6-2)31-26(29)20-17-11-8-12-18-20/h5-12,15-18,21-24H,1-2,13-14H2,3-4H3/t21-,22-,23+,24+/m1/s1 |
| InChIKey | INGKRZYNVWFIPD-LWSSLDFYSA-N |
| XLogP | 5.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|