C15H18O6 — CID 132597062
[(2R)-2-[(4R,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] benzoate (PubChem CID 132597062) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is [(2R)-2-[(4R,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] benzoate.
| Compound Name | [(2R)-2-[(4R,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] benzoate |
|---|---|
| PubChem CID | 132597062 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [(2R)-2-[(4R,5R)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] benzoate |
| SMILES | CC1(C)O[C@H]([C@H](O)COC(=O)c2ccccc2)[C@H](C=O)O1 |
| InChI | InChI=1S/C15H18O6/c1-15(2)20-12(8-16)13(21-15)11(17)9-19-14(18)10-6-4-3-5-7-10/h3-8,11-13,17H,9H2,1-2H3/t11-,12+,13-/m1/s1 |
| InChIKey | NDPYRQQVUSNTJP-FRRDWIJNSA-N |
| XLogP | 0.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|