C28H28I2O4 — CID 90414139
1-[(4R,5S)-5-(2,2-diiodoethenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol (PubChem CID 90414139) has the molecular formula C28H28I2O4 and a molecular weight of 682.34 g/mol. Its IUPAC name is 1-[(4R,5S)-5-(2,2-diiodoethenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol.
| Compound Name | 1-[(4R,5S)-5-(2,2-diiodoethenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol |
|---|---|
| PubChem CID | 90414139 |
| Molecular Formula | C28H28I2O4 |
| Molecular Weight | 682.34 g/mol |
| Exact Mass | 682.01 |
| IUPAC Name | 1-[(4R,5S)-5-(2,2-diiodoethenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanol |
| SMILES | CC1(C)O[C@@H](C=C(I)I)[C@@H](C(O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C28H28I2O4/c1-27(2)33-24(18-25(29)30)26(34-27)23(31)19-32-28(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-18,23-24,26,31H,19H2,1-2H3/t23?,24-,26+/m0/s1 |
| InChIKey | YEJOFKAHRAGRGR-GKZYAJIGSA-N |
| XLogP | 6.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.34 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|