C19H22O7 — CID 101040586
[(3aR,5S,6E,6aR)-6-(2-ethoxy-2-oxoethylidene)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate (PubChem CID 101040586) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(3aR,5S,6E,6aR)-6-(2-ethoxy-2-oxoethylidene)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate.
| Compound Name | [(3aR,5S,6E,6aR)-6-(2-ethoxy-2-oxoethylidene)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 101040586 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(3aR,5S,6E,6aR)-6-(2-ethoxy-2-oxoethylidene)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
| SMILES | CCOC(=O)/C=C1/[C@H]2OC(C)(C)O[C@H]2O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22O7/c1-4-22-15(20)10-13-14(24-18-16(13)25-19(2,3)26-18)11-23-17(21)12-8-6-5-7-9-12/h5-10,14,16,18H,4,11H2,1-3H3/b13-10+/t14-,16-,18-/m1/s1 |
| InChIKey | CNVOZMCACWUXQO-BZOPFQNJSA-N |
| XLogP | 2.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|