C15H18O4 — CID 134840498
[(4R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone (PubChem CID 134840498) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is [(4R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone.
| Compound Name | [(4R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134840498 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [(4R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone |
| SMILES | C=C[C@@H](O)[C@@H]1OC(C)(C)O[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-4-11(16)13-14(19-15(2,3)18-13)12(17)10-8-6-5-7-9-10/h4-9,11,13-14,16H,1H2,2-3H3/t11-,13+,14+/m1/s1 |
| InChIKey | GRXPUXJEPOCDFV-XBFCOCLRSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|