C31H33NO7 — CID 24767032
[(S)-[(4R,5R)-2,2-dimethyl-5-[(1S)-1-phenylmethoxypent-4-enyl]-1,3-dioxolan-4-yl]-phenylmethyl] 4-nitrobenzoate (PubChem CID 24767032) has the molecular formula C31H33NO7 and a molecular weight of 531.61 g/mol. Its IUPAC name is [(S)-[(4R,5R)-2,2-dimethyl-5-[(1S)-1-phenylmethoxypent-4-enyl]-1,3-dioxolan-4-yl]-phenylmethyl] 4-nitrobenzoate.
| Compound Name | [(S)-[(4R,5R)-2,2-dimethyl-5-[(1S)-1-phenylmethoxypent-4-enyl]-1,3-dioxolan-4-yl]-phenylmethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 24767032 |
| Molecular Formula | C31H33NO7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | [(S)-[(4R,5R)-2,2-dimethyl-5-[(1S)-1-phenylmethoxypent-4-enyl]-1,3-dioxolan-4-yl]-phenylmethyl] 4-nitrobenzoate |
| SMILES | C=CCC[C@H](OCc1ccccc1)[C@H]1OC(C)(C)O[C@@H]1[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C31H33NO7/c1-4-5-16-26(36-21-22-12-8-6-9-13-22)28-29(39-31(2,3)38-28)27(23-14-10-7-11-15-23)37-30(33)24-17-19-25(20-18-24)32(34)35/h4,6-15,17-20,26-29H,1,5,16,21H2,2-3H3/t26-,27-,28+,29+/m0/s1 |
| InChIKey | OQWFWOXLEQVUDV-QUAHOIDUSA-N |
| XLogP | 6.56 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|