C25H29NO7 — CID 10647423
[(Z,1S,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-phenylmethoxyhex-3-enyl] 4-nitrobenzoate (PubChem CID 10647423) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is [(Z,1S,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-phenylmethoxyhex-3-enyl] 4-nitrobenzoate.
| Compound Name | [(Z,1S,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-phenylmethoxyhex-3-enyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10647423 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [(Z,1S,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-phenylmethoxyhex-3-enyl] 4-nitrobenzoate |
| SMILES | C[C@@H](/C=C\C[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)[C@@H]1COC(C)(C)O1)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO7/c1-18(30-16-19-9-5-4-6-10-19)8-7-11-22(23-17-31-25(2,3)33-23)32-24(27)20-12-14-21(15-13-20)26(28)29/h4-10,12-15,18,22-23H,11,16-17H2,1-3H3/b8-7-/t18-,22-,23-/m0/s1 |
| InChIKey | SDWDDQKVMRTGKW-HPICATONSA-N |
| XLogP | 4.82 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|