C19H23NO6 — CID 134845532
[(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl] 4-nitrobenzoate (PubChem CID 134845532) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is [(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl] 4-nitrobenzoate.
| Compound Name | [(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 134845532 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl] 4-nitrobenzoate |
| SMILES | C=CC[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C19H23NO6/c1-2-6-16(17-13-24-19(26-17)11-4-3-5-12-19)25-18(21)14-7-9-15(10-8-14)20(22)23/h2,7-10,16-17H,1,3-6,11-13H2/t16-,17-/m1/s1 |
| InChIKey | APCZKLVMWBFJQH-IAGOWNOFSA-N |
| XLogP | 3.77 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|