C18H23NO6 — CID 11302525
[(3S)-3-ethyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl 4-nitrobenzoate (PubChem CID 11302525) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [(3S)-3-ethyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl 4-nitrobenzoate.
| Compound Name | [(3S)-3-ethyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 11302525 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(3S)-3-ethyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl 4-nitrobenzoate |
| SMILES | CC[C@@]1(COC(=O)c2ccc([N+](=O)[O-])cc2)COC2(CCCCC2)O1 |
| InChI | InChI=1S/C18H23NO6/c1-2-17(13-24-18(25-17)10-4-3-5-11-18)12-23-16(20)14-6-8-15(9-7-14)19(21)22/h6-9H,2-5,10-13H2,1H3/t17-/m1/s1 |
| InChIKey | NKKGPTJJVZTNID-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|