C21H18N2O8 — CID 98554477
[(1S,4S)-4-[(4-nitrobenzoyl)oxymethyl]-1-bicyclo[2.1.0]pentanyl]methyl 4-nitrobenzoate (PubChem CID 98554477) has the molecular formula C21H18N2O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is [(1S,4S)-4-[(4-nitrobenzoyl)oxymethyl]-1-bicyclo[2.1.0]pentanyl]methyl 4-nitrobenzoate.
| Compound Name | [(1S,4S)-4-[(4-nitrobenzoyl)oxymethyl]-1-bicyclo[2.1.0]pentanyl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 98554477 |
| Molecular Formula | C21H18N2O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [(1S,4S)-4-[(4-nitrobenzoyl)oxymethyl]-1-bicyclo[2.1.0]pentanyl]methyl 4-nitrobenzoate |
| SMILES | O=C(OC[C@]12CC[C@]1(COC(=O)c1ccc([N+](=O)[O-])cc1)C2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N2O8/c24-18(14-1-5-16(6-2-14)22(26)27)30-12-20-9-10-21(20,11-20)13-31-19(25)15-3-7-17(8-4-15)23(28)29/h1-8H,9-13H2/t20-,21-/m1/s1 |
| InChIKey | JHYRZAPTWAJSDK-NHCUHLMSSA-N |
| XLogP | 3.69 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|