C24H17NO4 — CID 98633911
[(2S,16S)-1-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenyl]methyl 4-nitrobenzoate (PubChem CID 98633911) has the molecular formula C24H17NO4 and a molecular weight of 383.40 g/mol. Its IUPAC name is [(2S,16S)-1-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenyl]methyl 4-nitrobenzoate.
| Compound Name | [(2S,16S)-1-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenyl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 98633911 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [(2S,16S)-1-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenyl]methyl 4-nitrobenzoate |
| SMILES | O=C(OCC12C3c4ccccc4[C@@H]1[C@H]2c1ccccc13)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17NO4/c26-23(14-9-11-15(12-10-14)25(27)28)29-13-24-20-16-5-1-3-7-18(16)21(24)22(24)19-8-4-2-6-17(19)20/h1-12,20-22H,13H2/t20?,21-,22-,24?/m1/s1 |
| InChIKey | PUCXQQXPKBPWFS-VCUAKTQDSA-N |
| XLogP | 4.78 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|