C18H23NO5 — CID 15316615
[(2S,3R)-3-cyclohexyl-2,3-dimethyloxiran-2-yl]methyl 4-nitrobenzoate (PubChem CID 15316615) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(2S,3R)-3-cyclohexyl-2,3-dimethyloxiran-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2S,3R)-3-cyclohexyl-2,3-dimethyloxiran-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 15316615 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(2S,3R)-3-cyclohexyl-2,3-dimethyloxiran-2-yl]methyl 4-nitrobenzoate |
| SMILES | C[C@@]1(COC(=O)c2ccc([N+](=O)[O-])cc2)O[C@]1(C)C1CCCCC1 |
| InChI | InChI=1S/C18H23NO5/c1-17(18(2,24-17)14-6-4-3-5-7-14)12-23-16(20)13-8-10-15(11-9-13)19(21)22/h8-11,14H,3-7,12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | YHUGBEAFKNBIDC-ZWKOTPCHSA-N |
| XLogP | 3.88 |
| TPSA | 81.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|