C17H21N2O6+ — CID 7298319
[(1R,7R)-1,7-dimethyl-2,6-dioxa-10-azoniatricyclo[5.2.1.04,10]decan-4-yl]methyl 4-nitrobenzoate (PubChem CID 7298319) has the molecular formula C17H21N2O6+ and a molecular weight of 349.36 g/mol. Its IUPAC name is [(1R,7R)-1,7-dimethyl-2,6-dioxa-10-azoniatricyclo[5.2.1.04,10]decan-4-yl]methyl 4-nitrobenzoate.
| Compound Name | [(1R,7R)-1,7-dimethyl-2,6-dioxa-10-azoniatricyclo[5.2.1.04,10]decan-4-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 7298319 |
| Molecular Formula | C17H21N2O6+ |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [(1R,7R)-1,7-dimethyl-2,6-dioxa-10-azoniatricyclo[5.2.1.04,10]decan-4-yl]methyl 4-nitrobenzoate |
| SMILES | C[C@]12CC[C@@]3(C)OCC(COC(=O)c4ccc([N+](=O)[O-])cc4)(CO1)[NH+]23 |
| InChI | InChI=1S/C17H20N2O6/c1-15-7-8-16(2)19(15)17(10-24-15,11-25-16)9-23-14(20)12-3-5-13(6-4-12)18(21)22/h3-6H,7-11H2,1-2H3/p+1/t15-,16-/m1/s1 |
| InChIKey | INUNALBSOMANMB-HZPDHXFCSA-O |
| XLogP | 0.66 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|