C27H21F3N2O8 — CID 139091983
[(1S,2S,3S)-2-benzyl-2-[(4-nitrobenzoyl)oxymethyl]-3-(trifluoromethyl)cyclopropyl]methyl 4-nitrobenzoate (PubChem CID 139091983) has the molecular formula C27H21F3N2O8 and a molecular weight of 558.47 g/mol. Its IUPAC name is [(1S,2S,3S)-2-benzyl-2-[(4-nitrobenzoyl)oxymethyl]-3-(trifluoromethyl)cyclopropyl]methyl 4-nitrobenzoate.
| Compound Name | [(1S,2S,3S)-2-benzyl-2-[(4-nitrobenzoyl)oxymethyl]-3-(trifluoromethyl)cyclopropyl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 139091983 |
| Molecular Formula | C27H21F3N2O8 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | [(1S,2S,3S)-2-benzyl-2-[(4-nitrobenzoyl)oxymethyl]-3-(trifluoromethyl)cyclopropyl]methyl 4-nitrobenzoate |
| SMILES | O=C(OC[C@H]1[C@H](C(F)(F)F)[C@]1(COC(=O)c1ccc([N+](=O)[O-])cc1)Cc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H21F3N2O8/c28-27(29,30)23-22(15-39-24(33)18-6-10-20(11-7-18)31(35)36)26(23,14-17-4-2-1-3-5-17)16-40-25(34)19-8-12-21(13-9-19)32(37)38/h1-13,22-23H,14-16H2/t22-,23-,26-/m0/s1 |
| InChIKey | KIZOSYZHJQLENB-FXSPECFOSA-N |
| XLogP | 5.55 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|