About [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate
[(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate (PubChem CID 15857496) has the molecular formula C24H20N2O7S
and a molecular weight of 480.50 g/mol. Its IUPAC name is [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate |
| PubChem CID | 15857496 |
| Molecular Formula | C24H20N2O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1[C@@H](Cc2ccccc2)C(=O)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O7S/c27-23-21(15-17-7-3-1-4-8-17)22(16-33-24(28)18-9-5-2-6-10-18)25(23)34(31,32)20-13-11-19(12-14-20)26(29)30/h1-14,21-22H,15-16H2/t21-,22+/m1/s1 |
| InChIKey | WPEODRYHIIBRHR-YADHBBJMSA-N |
| XLogP | 3.21 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate?
The IUPAC name of [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate (CID 15857496) is [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate.
What is the SMILES notation for [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate?
The canonical SMILES for [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate is O=C(OC[C@H]1[C@@H](Cc2ccccc2)C(=O)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1.
What is the InChIKey of [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate?
The InChIKey is WPEODRYHIIBRHR-YADHBBJMSA-N. The full InChI is InChI=1S/C24H20N2O7S/c27-23-21(15-17-7-3-1-4-8-17)22(16-33-24(28)18-9-5-2-6-10-18)25(23)34(31,32)20-13-11-19(12-14-20)26(29)30/h1-14,21-22H,15-16H2/t21-,22+/m1/s1.
What are the key properties of [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate?
[(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate has a molecular weight of 480.50 g/mol, XLogP of 3.21, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-benzyl-1-(4-nitrophenyl)sulfonyl-4-oxoazetidin-2-yl]methyl benzoate is sourced from PubChem (CID 15857496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).