C20H19N3O6S — CID 101481463
benzyl (1R,2R,6S)-2-methyl-7-(4-nitrophenyl)sulfonyl-3,7-diazabicyclo[4.1.0]hept-4-ene-3-carboxylate (PubChem CID 101481463) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is benzyl (1R,2R,6S)-2-methyl-7-(4-nitrophenyl)sulfonyl-3,7-diazabicyclo[4.1.0]hept-4-ene-3-carboxylate.
| Compound Name | benzyl (1R,2R,6S)-2-methyl-7-(4-nitrophenyl)sulfonyl-3,7-diazabicyclo[4.1.0]hept-4-ene-3-carboxylate |
|---|---|
| PubChem CID | 101481463 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | benzyl (1R,2R,6S)-2-methyl-7-(4-nitrophenyl)sulfonyl-3,7-diazabicyclo[4.1.0]hept-4-ene-3-carboxylate |
| SMILES | C[C@@H]1[C@@H]2[C@H](C=CN1C(=O)OCc1ccccc1)N2S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N3O6S/c1-14-19-18(11-12-21(14)20(24)29-13-15-5-3-2-4-6-15)22(19)30(27,28)17-9-7-16(8-10-17)23(25)26/h2-12,14,18-19H,13H2,1H3/t14-,18+,19-,22?/m1/s1 |
| InChIKey | ZCNMMYLXKBPKSE-QQUDGMTESA-N |
| XLogP | 2.89 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|