C27H25N3O7 — CID 102254937
dibenzyl (1S,4R,5R)-5-(4-nitrophenoxy)-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 102254937) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is dibenzyl (1S,4R,5R)-5-(4-nitrophenoxy)-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dibenzyl (1S,4R,5R)-5-(4-nitrophenoxy)-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102254937 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | dibenzyl (1S,4R,5R)-5-(4-nitrophenoxy)-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)N1[C@H]2C[C@H]([C@H](Oc3ccc([N+](=O)[O-])cc3)C2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O7/c31-26(35-17-19-7-3-1-4-8-19)28-22-15-24(29(28)27(32)36-18-20-9-5-2-6-10-20)25(16-22)37-23-13-11-21(12-14-23)30(33)34/h1-14,22,24-25H,15-18H2/t22-,24+,25+/m0/s1 |
| InChIKey | SRDCVHSZICVJDE-ICDZXHCJSA-N |
| XLogP | 5.08 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|