C20H23N3O6S — CID 102341804
benzyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate (PubChem CID 102341804) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is benzyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 102341804 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | benzyl (3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OCc2ccccc2)CCCN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N3O6S/c1-16-14-21(20(24)29-15-17-8-3-2-4-9-17)12-7-13-22(16)30(27,28)19-11-6-5-10-18(19)23(25)26/h2-6,8-11,16H,7,12-15H2,1H3/t16-/m0/s1 |
| InChIKey | WTPIGVXIDLJYBC-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|