C22H24FN3O6S — CID 56949724
benzyl (3S,4R)-3-[[cyclopropyl-(2-nitrophenyl)sulfonylamino]methyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 56949724) has the molecular formula C22H24FN3O6S and a molecular weight of 477.51 g/mol. Its IUPAC name is benzyl (3S,4R)-3-[[cyclopropyl-(2-nitrophenyl)sulfonylamino]methyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S,4R)-3-[[cyclopropyl-(2-nitrophenyl)sulfonylamino]methyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56949724 |
| Molecular Formula | C22H24FN3O6S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | benzyl (3S,4R)-3-[[cyclopropyl-(2-nitrophenyl)sulfonylamino]methyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H](CN(C2CC2)S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](F)C1 |
| InChI | InChI=1S/C22H24FN3O6S/c23-19-14-24(22(27)32-15-16-6-2-1-3-7-16)12-17(19)13-25(18-10-11-18)33(30,31)21-9-5-4-8-20(21)26(28)29/h1-9,17-19H,10-15H2/t17-,19-/m0/s1 |
| InChIKey | JJYRAXQIDWJIJB-HKUYNNGSSA-N |
| XLogP | 3.35 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|