C19H21N3O7S — CID 163246604
benzyl (6R)-6-hydroxy-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate (PubChem CID 163246604) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is benzyl (6R)-6-hydroxy-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl (6R)-6-hydroxy-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 163246604 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | benzyl (6R)-6-hydroxy-4-(2-nitrophenyl)sulfonyl-1,4-diazepane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C[C@H](O)C1 |
| InChI | InChI=1S/C19H21N3O7S/c23-16-12-20(19(24)29-14-15-6-2-1-3-7-15)10-11-21(13-16)30(27,28)18-9-5-4-8-17(18)22(25)26/h1-9,16,23H,10-14H2/t16-/m1/s1 |
| InChIKey | NDOKANMUYAVEMW-MRXNPFEDSA-N |
| XLogP | 1.60 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|